Editing Deoxyuridine

{{Chembox
| Verifiedfields = changed
| verifiedrevid = 396326381
| ImageFile=Desoxyuridin.svg
| ImageSize=150
| ImageAlt=Skeletal formula of deoxyuridine
| ImageFile1=Deoxyuridine 3D ball.png
| ImageSize1=200
| ImageAlt1=Ball-and-stick model of the deoxyuridine molecule
| IUPACName=2′-Deoxyuridine
| SystematicName=1-[(2''R'',4''S'',5''R'')-4-Hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4(1''H'',3''H'')-dione
| OtherNames=
|Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 13118
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 353955
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = W78I7AY22C
| InChI = 1/C9H12N2O5/c12-4-6-5(13)3-8(16-6)11-2-1-7(14)10-9(11)15/h1-2,5-6,8,12-13H,3-4H2,(H,10,14,15)/t5-,6+,8+/m0/s1
| InChIKey = MXHRCPNRJAMMIM-SHYZEUOFBK
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C9H12N2O5/c12-4-6-5(13)3-8(16-6)11-2-1-7(14)10-9(11)15/h1-2,5-6,8,12-13H,3-4H2,(H,10,14,15)/t5-,6+,8+/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = MXHRCPNRJAMMIM-SHYZEUOFSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo=951-78-0
| PubChem=640
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 16450
| SMILES = O=C/1NC(=O)N(\C=C\1)[C@@H]2O[C@@H]([C@@H](O)C2)CO
| MeSHName=Deoxyuridine
  }}
|Section2={{Chembox Properties
| Formula=C<sub>9</sub>H<sub>12</sub>N<sub>2</sub>O<sub>5</sub>
| MolarMass=228.202
| Appearance=
| Density=
| MeltingPt=
| BoilingPt=
| Solubility=
  }}
|Section3={{Chembox Hazards
| MainHazards=
| FlashPt=
| AutoignitionPt =
  }}
}}
'''Deoxyuridine''' ('''dU''') is a [[Chemical compound|compound]] and a [[nucleoside]]. It belongs to a class of compounds known as Pyrimidine 2'-deoxyribonucleosides<ref>{{Cite web|url=http://www.hmdb.ca/metabolites/HMDB0000012|title=Human Metabolome Database: Showing metabocard for Deoxyuridine (HMDB0000012)|website=www.hmdb.ca|access-date=2019-12-05}}</ref> and closely resembles the chemical composition of uridine but without the presence of the 2' hydroxyl group. [[Idoxuridine]] and [[Trifluridine]] are variants of deoxyuridine used as [[antiviral drug]]s. They are similar enough to be incorporated as part of [[DNA replication]], but they possess side groups on the [[uracil]] component (an [[iodine]] and a CF<sub>3</sub> group, respectively), that prevent [[base pair]]ing. A known use of '''dU''' is as a precursor in the synthesis of [[Edoxudine]].<ref>{{Cite web|url=https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:16450|title=2'-deoxyuridine (CHEBI:16450)|website=www.ebi.ac.uk|access-date=2019-12-05}}</ref>

This compound exists in all living organisms and can become part of DNA in both prokaryotic and eukaryotic cells through two mechanisms. The first is the removal of an amino group from cytosine to result in uracil and the second is the non-intentional incorporation of pyrimidine where thymine belongs in the DNA, resulting in dUMP.<ref>{{Cite journal|last=Richards|first=R. G.|last2=Sowers|first2=L. C.|last3=Laszlo|first3=J.|last4=Sedwick|first4=W. D.|date=1984|title=The occurrence and consequences of deoxyuridine in DNA|url=https://www.ncbi.nlm.nih.gov/pubmed/6147963|journal=Advances in Enzyme Regulation|volume=22|pages=157–185|doi=10.1016/0065-2571(84)90013-x|issn=0065-2571|pmid=6147963}}</ref> 

UMP synthase deficiency is a metabolic disorder in humans that involves deoxyuridine. Deoxyuridine can be toxic. It has also been found in several foods, which makes it a useful indicator for diseases through consumption of those foods.<ref>{{Cite web|url=http://www.hmdb.ca/metabolites/HMDB0000012|title=Human Metabolome Database: Showing metabocard for Deoxyuridine (HMDB0000012)|website=www.hmdb.ca|access-date=2019-12-05}}</ref>

== References ==
{{reflist}}


{{Nucleobases, nucleosides, and nucleotides}}

[[Category:Nucleosides]]
[[Category:Pyrimidinediones]]